C22H23ClN4O3S — CID 4077023
N-[3-[4-(3-chloro-4-methoxyphenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 4077023) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is N-[3-[4-(3-chloro-4-methoxyphenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[4-(3-chloro-4-methoxyphenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 4077023 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[3-[4-(3-chloro-4-methoxyphenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | COc1ccc(-n2c(CCCNC(C)=O)nnc2SCC(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H23ClN4O3S/c1-15(28)24-12-6-9-21-25-26-22(31-14-19(29)16-7-4-3-5-8-16)27(21)17-10-11-20(30-2)18(23)13-17/h3-5,7-8,10-11,13H,6,9,12,14H2,1-2H3,(H,24,28) |
| InChIKey | NCLVCMNOWDKDCR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|