C21H20Cl2N4O2S — CID 5159538
N-[3-[4-(3,4-dichlorophenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 5159538) has the molecular formula C21H20Cl2N4O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichlorophenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[4-(3,4-dichlorophenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 5159538 |
| Molecular Formula | C21H20Cl2N4O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-[3-[4-(3,4-dichlorophenyl)-5-phenacylsulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1nnc(SCC(=O)c2ccccc2)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H20Cl2N4O2S/c1-14(28)24-11-5-8-20-25-26-21(27(20)16-9-10-17(22)18(23)12-16)30-13-19(29)15-6-3-2-4-7-15/h2-4,6-7,9-10,12H,5,8,11,13H2,1H3,(H,24,28) |
| InChIKey | QPGNMZXKKFKGCP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|