C21H19Cl2IN4O2S — CID 5175500
N-[3-[4-(3,5-dichlorophenyl)-5-[2-(4-iodophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 5175500) has the molecular formula C21H19Cl2IN4O2S and a molecular weight of 589.29 g/mol. Its IUPAC name is N-[3-[4-(3,5-dichlorophenyl)-5-[2-(4-iodophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[4-(3,5-dichlorophenyl)-5-[2-(4-iodophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 5175500 |
| Molecular Formula | C21H19Cl2IN4O2S |
| Molecular Weight | 589.29 g/mol |
| Exact Mass | 587.97 |
| IUPAC Name | N-[3-[4-(3,5-dichlorophenyl)-5-[2-(4-iodophenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1nnc(SCC(=O)c2ccc(I)cc2)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2IN4O2S/c1-13(29)25-8-2-3-20-26-27-21(28(20)18-10-15(22)9-16(23)11-18)31-12-19(30)14-4-6-17(24)7-5-14/h4-7,9-11H,2-3,8,12H2,1H3,(H,25,29) |
| InChIKey | JNUWXCKRTAEUGE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.29 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|