C22H23IN4O2S — CID 5153243
N-[3-[4-(4-iodophenyl)-5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 5153243) has the molecular formula C22H23IN4O2S and a molecular weight of 534.42 g/mol. Its IUPAC name is N-[3-[4-(4-iodophenyl)-5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[4-(4-iodophenyl)-5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 5153243 |
| Molecular Formula | C22H23IN4O2S |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | N-[3-[4-(4-iodophenyl)-5-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1nnc(SCC(=O)c2ccc(C)cc2)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C22H23IN4O2S/c1-15-5-7-17(8-6-15)20(29)14-30-22-26-25-21(4-3-13-24-16(2)28)27(22)19-11-9-18(23)10-12-19/h5-12H,3-4,13-14H2,1-2H3,(H,24,28) |
| InChIKey | UYOZZWUWZCTZKT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|