C11H13BrClN5 — CID 113445682
N-[[1-(2-bromo-5-chloro-4-methylphenyl)tetrazol-5-yl]methyl]ethanamine (PubChem CID 113445682) has the molecular formula C11H13BrClN5 and a molecular weight of 330.62 g/mol. Its IUPAC name is N-[[1-(2-bromo-5-chloro-4-methylphenyl)tetrazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[1-(2-bromo-5-chloro-4-methylphenyl)tetrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 113445682 |
| Molecular Formula | C11H13BrClN5 |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-[[1-(2-bromo-5-chloro-4-methylphenyl)tetrazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1nnnn1-c1cc(Cl)c(C)cc1Br |
| InChI | InChI=1S/C11H13BrClN5/c1-3-14-6-11-15-16-17-18(11)10-5-9(13)7(2)4-8(10)12/h4-5,14H,3,6H2,1-2H3 |
| InChIKey | PRQNLEPANSUCRH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |