C10H10F3N5 — CID 62809896
N-[[1-(2,4,5-trifluorophenyl)tetrazol-5-yl]methyl]ethanamine (PubChem CID 62809896) has the molecular formula C10H10F3N5 and a molecular weight of 257.22 g/mol. Its IUPAC name is N-[[1-(2,4,5-trifluorophenyl)tetrazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[1-(2,4,5-trifluorophenyl)tetrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62809896 |
| Molecular Formula | C10H10F3N5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[[1-(2,4,5-trifluorophenyl)tetrazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1nnnn1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H10F3N5/c1-2-14-5-10-15-16-17-18(10)9-4-7(12)6(11)3-8(9)13/h3-4,14H,2,5H2,1H3 |
| InChIKey | QYGGLPZVIBUVIZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|