About 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid
5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid (PubChem CID 60827521) has the molecular formula C10H8F2N4O2
and a molecular weight of 254.20 g/mol. Its IUPAC name is 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid.
Molecular Properties
| Compound Name | 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid |
| PubChem CID | 60827521 |
| Molecular Formula | C10H8F2N4O2 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid |
| SMILES | CCc1nnnn1-c1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C10H8F2N4O2/c1-2-9-13-14-15-16(9)8-3-5(10(17)18)6(11)4-7(8)12/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | WEZLILUGRJSCAN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid?
The IUPAC name of 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid (CID 60827521) is 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid.
What is the SMILES notation for 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid?
The canonical SMILES for 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid is CCc1nnnn1-c1cc(C(=O)O)c(F)cc1F.
What is the InChIKey of 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid?
The InChIKey is WEZLILUGRJSCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N4O2/c1-2-9-13-14-15-16(9)8-3-5(10(17)18)6(11)4-7(8)12/h3-4H,2H2,1H3,(H,17,18).
What are the key properties of 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid?
5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid has a molecular weight of 254.20 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-ethyltetrazol-1-yl)-2,4-difluorobenzoic acid is sourced from PubChem (CID 60827521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).