C10H9F4N5 — CID 107646049
N-[[1-(2,3,5,6-tetrafluorophenyl)tetrazol-5-yl]methyl]ethanamine (PubChem CID 107646049) has the molecular formula C10H9F4N5 and a molecular weight of 275.21 g/mol. Its IUPAC name is N-[[1-(2,3,5,6-tetrafluorophenyl)tetrazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[1-(2,3,5,6-tetrafluorophenyl)tetrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 107646049 |
| Molecular Formula | C10H9F4N5 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-[[1-(2,3,5,6-tetrafluorophenyl)tetrazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1nnnn1-c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H9F4N5/c1-2-15-4-7-16-17-18-19(7)10-8(13)5(11)3-6(12)9(10)14/h3,15H,2,4H2,1H3 |
| InChIKey | JSJUDVJQLKLVAA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|