About N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine
N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine (PubChem CID 103084921) has the molecular formula C13H17Br2N5
and a molecular weight of 403.12 g/mol. Its IUPAC name is N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine |
| PubChem CID | 103084921 |
| Molecular Formula | C13H17Br2N5 |
| Molecular Weight | 403.12 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1nnnn1-c1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C13H17Br2N5/c1-4-5-16-9(3)13-17-18-19-20(13)12-10(14)6-8(2)7-11(12)15/h6-7,9,16H,4-5H2,1-3H3 |
| InChIKey | OJFFJFHFWJVCNC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine?
The IUPAC name of N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine (CID 103084921) is N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine.
What is the SMILES notation for N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine?
The canonical SMILES for N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine is CCCNC(C)c1nnnn1-c1c(Br)cc(C)cc1Br.
What is the InChIKey of N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine?
The InChIKey is OJFFJFHFWJVCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Br2N5/c1-4-5-16-9(3)13-17-18-19-20(13)12-10(14)6-8(2)7-11(12)15/h6-7,9,16H,4-5H2,1-3H3.
What are the key properties of N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine?
N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine has a molecular weight of 403.12 g/mol, XLogP of 3.56, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethyl]propan-1-amine is sourced from PubChem (CID 103084921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).