C10H11Br2N5 — CID 103084917
1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethanamine (PubChem CID 103084917) has the molecular formula C10H11Br2N5 and a molecular weight of 361.04 g/mol. Its IUPAC name is 1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethanamine.
| Compound Name | 1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103084917 |
| Molecular Formula | C10H11Br2N5 |
| Molecular Weight | 361.04 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | 1-[1-(2,6-dibromo-4-methylphenyl)tetrazol-5-yl]ethanamine |
| SMILES | Cc1cc(Br)c(-n2nnnc2C(C)N)c(Br)c1 |
| InChI | InChI=1S/C10H11Br2N5/c1-5-3-7(11)9(8(12)4-5)17-10(6(2)13)14-15-16-17/h3-4,6H,13H2,1-2H3 |
| InChIKey | OTFVFMMXQQEHLK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.04 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |