C11H13Cl2N5O — CID 62737012
N-[[1-(2,4-dichlorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 62737012) has the molecular formula C11H13Cl2N5O and a molecular weight of 302.17 g/mol. Its IUPAC name is N-[[1-(2,4-dichlorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(2,4-dichlorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 62737012 |
| Molecular Formula | C11H13Cl2N5O |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-[[1-(2,4-dichlorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnnn1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2N5O/c1-19-5-4-14-7-11-15-16-17-18(11)10-3-2-8(12)6-9(10)13/h2-3,6,14H,4-5,7H2,1H3 |
| InChIKey | RTAHTSFBQLUBKZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|