C11H13ClIN5 — CID 107639450
N-[[1-(4-chloro-2-iodophenyl)tetrazol-5-yl]methyl]propan-1-amine (PubChem CID 107639450) has the molecular formula C11H13ClIN5 and a molecular weight of 377.62 g/mol. Its IUPAC name is N-[[1-(4-chloro-2-iodophenyl)tetrazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(4-chloro-2-iodophenyl)tetrazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107639450 |
| Molecular Formula | C11H13ClIN5 |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-[[1-(4-chloro-2-iodophenyl)tetrazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnnn1-c1ccc(Cl)cc1I |
| InChI | InChI=1S/C11H13ClIN5/c1-2-5-14-7-11-15-16-17-18(11)10-4-3-8(12)6-9(10)13/h3-4,6,14H,2,5,7H2,1H3 |
| InChIKey | LICAQPYBIKRLIM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|