C12H13ClF3N5 — CID 62737745
N-[[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-1-amine (PubChem CID 62737745) has the molecular formula C12H13ClF3N5 and a molecular weight of 319.72 g/mol. Its IUPAC name is N-[[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62737745 |
| Molecular Formula | C12H13ClF3N5 |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[[1-[4-chloro-3-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnnn1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3N5/c1-2-5-17-7-11-18-19-20-21(11)8-3-4-10(13)9(6-8)12(14,15)16/h3-4,6,17H,2,5,7H2,1H3 |
| InChIKey | MAXZINXUNKFVBM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|