C13H19N5O2 — CID 62737780
N-[[1-(3,4-dimethoxyphenyl)tetrazol-5-yl]methyl]propan-1-amine (PubChem CID 62737780) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[[1-(3,4-dimethoxyphenyl)tetrazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(3,4-dimethoxyphenyl)tetrazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62737780 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[[1-(3,4-dimethoxyphenyl)tetrazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnnn1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H19N5O2/c1-4-7-14-9-13-15-16-17-18(13)10-5-6-11(19-2)12(8-10)20-3/h5-6,8,14H,4,7,9H2,1-3H3 |
| InChIKey | NRZQKZMOJRVTDF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|