C25H36ClN5O2 — CID 17333385
N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]octan-1-amine;hydrochloride (PubChem CID 17333385) has the molecular formula C25H36ClN5O2 and a molecular weight of 474.05 g/mol. Its IUPAC name is N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]octan-1-amine;hydrochloride.
| Compound Name | N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]octan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17333385 |
| Molecular Formula | C25H36ClN5O2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]octan-1-amine;hydrochloride |
| SMILES | CCCCCCCCNCc1ccc(OCc2nnnn2-c2ccc(C)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C25H35N5O2.ClH/c1-4-5-6-7-8-9-16-26-18-21-12-15-23(24(17-21)31-3)32-19-25-27-28-29-30(25)22-13-10-20(2)11-14-22;/h10-15,17,26H,4-9,16,18-19H2,1-3H3;1H |
| InChIKey | FENHWTGGAJTXQR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|