C22H30ClN5O2 — CID 17212445
N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]heptan-1-amine;hydrochloride (PubChem CID 17212445) has the molecular formula C22H30ClN5O2 and a molecular weight of 431.97 g/mol. Its IUPAC name is N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]heptan-1-amine;hydrochloride.
| Compound Name | N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]heptan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17212445 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]heptan-1-amine;hydrochloride |
| SMILES | CCCCCCCNCc1ccc(Oc2nnnn2-c2ccccc2)c(OC)c1.Cl |
| InChI | InChI=1S/C22H29N5O2.ClH/c1-3-4-5-6-10-15-23-17-18-13-14-20(21(16-18)28-2)29-22-24-25-26-27(22)19-11-8-7-9-12-19;/h7-9,11-14,16,23H,3-6,10,15,17H2,1-2H3;1H |
| InChIKey | POAICYPEEIZMBK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|