C24H26ClN5O3 — CID 17212453
2-(4-methoxyphenyl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride (PubChem CID 17212453) has the molecular formula C24H26ClN5O3 and a molecular weight of 467.96 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17212453 |
| Molecular Formula | C24H26ClN5O3 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2ccc(Oc3nnnn3-c3ccccc3)c(OC)c2)cc1.Cl |
| InChI | InChI=1S/C24H25N5O3.ClH/c1-30-21-11-8-18(9-12-21)14-15-25-17-19-10-13-22(23(16-19)31-2)32-24-26-27-28-29(24)20-6-4-3-5-7-20;/h3-13,16,25H,14-15,17H2,1-2H3;1H |
| InChIKey | ICYYVAZKKSNSJB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|