C20H26ClN5O3 — CID 17209516
N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-methoxypropan-1-amine;hydrochloride (PubChem CID 17209516) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-methoxypropan-1-amine;hydrochloride.
| Compound Name | N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-methoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17209516 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-methoxypropan-1-amine;hydrochloride |
| SMILES | CCOc1cc(CNCCCOC)ccc1Oc1nnnn1-c1ccccc1.Cl |
| InChI | InChI=1S/C20H25N5O3.ClH/c1-3-27-19-14-16(15-21-12-7-13-26-2)10-11-18(19)28-20-22-23-24-25(20)17-8-5-4-6-9-17;/h4-6,8-11,14,21H,3,7,12-13,15H2,1-2H3;1H |
| InChIKey | NCXGEFHLMWPBEP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|