C18H22ClN5O2 — CID 132902394
3-methoxy-N-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propan-1-amine;hydrochloride (PubChem CID 132902394) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-methoxy-N-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-methoxy-N-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 132902394 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-methoxy-N-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propan-1-amine;hydrochloride |
| SMILES | COCCCNCc1ccc(Oc2nnnn2-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H21N5O2.ClH/c1-24-13-5-12-19-14-15-8-10-17(11-9-15)25-18-20-21-22-23(18)16-6-3-2-4-7-16;/h2-4,6-11,19H,5,12-14H2,1H3;1H |
| InChIKey | JZOSIDRXPMKYMK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|