C17H20ClN5O3 — CID 17206350
2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]ethanol;hydrochloride (PubChem CID 17206350) has the molecular formula C17H20ClN5O3 and a molecular weight of 377.83 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]ethanol;hydrochloride.
| Compound Name | 2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17206350 |
| Molecular Formula | C17H20ClN5O3 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]ethanol;hydrochloride |
| SMILES | COc1cc(CNCCO)ccc1Oc1nnnn1-c1ccccc1.Cl |
| InChI | InChI=1S/C17H19N5O3.ClH/c1-24-16-11-13(12-18-9-10-23)7-8-15(16)25-17-19-20-21-22(17)14-5-3-2-4-6-14;/h2-8,11,18,23H,9-10,12H2,1H3;1H |
| InChIKey | JYPFEUCITGTYBP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|