C18H19N5O4 — CID 66527838
2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]propanoic acid (PubChem CID 66527838) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]propanoic acid.
| Compound Name | 2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 66527838 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]propanoic acid |
| SMILES | COc1cc(CNC(C)C(=O)O)ccc1Oc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C18H19N5O4/c1-12(17(24)25)19-11-13-8-9-15(16(10-13)26-2)27-18-20-21-22-23(18)14-6-4-3-5-7-14/h3-10,12,19H,11H2,1-2H3,(H,24,25) |
| InChIKey | RDQZXOVUASNVDC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |