C22H18ClN5O4 — CID 66538787
2-chloro-5-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid (PubChem CID 66538787) has the molecular formula C22H18ClN5O4 and a molecular weight of 451.87 g/mol. Its IUPAC name is 2-chloro-5-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid.
| Compound Name | 2-chloro-5-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 66538787 |
| Molecular Formula | C22H18ClN5O4 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-chloro-5-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid |
| SMILES | COc1cc(CNc2ccc(Cl)c(C(=O)O)c2)ccc1Oc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C22H18ClN5O4/c1-31-20-11-14(13-24-15-8-9-18(23)17(12-15)21(29)30)7-10-19(20)32-22-25-26-27-28(22)16-5-3-2-4-6-16/h2-12,24H,13H2,1H3,(H,29,30) |
| InChIKey | JNKSUJJAAUEGPI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |