C24H23N5O4 — CID 66538853
3-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]-2-methylbenzoic acid (PubChem CID 66538853) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 3-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]-2-methylbenzoic acid.
| Compound Name | 3-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 66538853 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 3-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]-2-methylbenzoic acid |
| SMILES | CCOc1cc(CNc2cccc(C(=O)O)c2C)ccc1Oc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C24H23N5O4/c1-3-32-22-14-17(15-25-20-11-7-10-19(16(20)2)23(30)31)12-13-21(22)33-24-26-27-28-29(24)18-8-5-4-6-9-18/h4-14,25H,3,15H2,1-2H3,(H,30,31) |
| InChIKey | LPRMTDLCAZTUGB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |