C21H26ClN5O2 — CID 17151701
N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cyclopentanamine;hydrochloride (PubChem CID 17151701) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cyclopentanamine;hydrochloride.
| Compound Name | N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cyclopentanamine;hydrochloride |
|---|---|
| PubChem CID | 17151701 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cyclopentanamine;hydrochloride |
| SMILES | CCOc1cc(CNC2CCCC2)ccc1Oc1nnnn1-c1ccccc1.Cl |
| InChI | InChI=1S/C21H25N5O2.ClH/c1-2-27-20-14-16(15-22-17-8-6-7-9-17)12-13-19(20)28-21-23-24-25-26(21)18-10-4-3-5-11-18;/h3-5,10-14,17,22H,2,6-9,15H2,1H3;1H |
| InChIKey | YDYZLSWGOICGIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |