C27H40N6O2 — CID 17214885
N',N'-dibutyl-N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propane-1,3-diamine (PubChem CID 17214885) has the molecular formula C27H40N6O2 and a molecular weight of 480.66 g/mol. Its IUPAC name is N',N'-dibutyl-N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17214885 |
| Molecular Formula | C27H40N6O2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | N',N'-dibutyl-N-[[3-ethoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(Oc2nnnn2-c2ccccc2)c(OCC)c1 |
| InChI | InChI=1S/C27H40N6O2/c1-4-7-18-32(19-8-5-2)20-12-17-28-22-23-15-16-25(26(21-23)34-6-3)35-27-29-30-31-33(27)24-13-10-9-11-14-24/h9-11,13-16,21,28H,4-8,12,17-20,22H2,1-3H3 |
| InChIKey | NIMDMFRCHUKJBC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|