C21H25N5O — CID 17206293
N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cycloheptanamine (PubChem CID 17206293) has the molecular formula C21H25N5O and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cycloheptanamine.
| Compound Name | N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cycloheptanamine |
|---|---|
| PubChem CID | 17206293 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]cycloheptanamine |
| SMILES | c1ccc(-n2nnnc2Oc2cccc(CNC3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H25N5O/c1-2-5-11-18(10-4-1)22-16-17-9-8-14-20(15-17)27-21-23-24-25-26(21)19-12-6-3-7-13-19/h3,6-9,12-15,18,22H,1-2,4-5,10-11,16H2 |
| InChIKey | NTSCBPRZHIBADT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |