C16H23N5 — CID 60673062
N-[(1-phenyltetrazol-5-yl)methyl]cyclooctanamine (PubChem CID 60673062) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[(1-phenyltetrazol-5-yl)methyl]cyclooctanamine.
| Compound Name | N-[(1-phenyltetrazol-5-yl)methyl]cyclooctanamine |
|---|---|
| PubChem CID | 60673062 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-[(1-phenyltetrazol-5-yl)methyl]cyclooctanamine |
| SMILES | c1ccc(-n2nnnc2CNC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C16H23N5/c1-2-5-9-14(10-6-3-1)17-13-16-18-19-20-21(16)15-11-7-4-8-12-15/h4,7-8,11-12,14,17H,1-3,5-6,9-10,13H2 |
| InChIKey | AYNQJDHKUBSXRP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |