C16H20N8 — CID 95340139
(6S)-2-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95340139) has the molecular formula C16H20N8 and a molecular weight of 324.39 g/mol. Its IUPAC name is (6S)-2-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-2-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95340139 |
| Molecular Formula | C16H20N8 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (6S)-2-ethyl-N-[(1-phenyltetrazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@@H](NCc1nnnn1-c1ccccc1)CC2 |
| InChI | InChI=1S/C16H20N8/c1-2-14-18-15-9-8-12(11-23(15)20-14)17-10-16-19-21-22-24(16)13-6-4-3-5-7-13/h3-7,12,17H,2,8-11H2,1H3/t12-/m0/s1 |
| InChIKey | ADHKFFOFGOHVAI-LBPRGKRZSA-N |
| XLogP | 0.92 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |