C16H22N4O — CID 95607448
(1S)-2-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-phenylethanol (PubChem CID 95607448) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is (1S)-2-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-phenylethanol.
| Compound Name | (1S)-2-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 95607448 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (1S)-2-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-1-phenylethanol |
| SMILES | CCc1nc2n(n1)C[C@@H](NC[C@@H](O)c1ccccc1)CC2 |
| InChI | InChI=1S/C16H22N4O/c1-2-15-18-16-9-8-13(11-20(16)19-15)17-10-14(21)12-6-4-3-5-7-12/h3-7,13-14,17,21H,2,8-11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | MCRPOVUQMKDJEI-UONOGXRCSA-N |
| XLogP | 1.48 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |