C15H19ClN4O — CID 95979079
(1R)-1-(2-chlorophenyl)-2-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanol (PubChem CID 95979079) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is (1R)-1-(2-chlorophenyl)-2-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanol.
| Compound Name | (1R)-1-(2-chlorophenyl)-2-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 95979079 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (1R)-1-(2-chlorophenyl)-2-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanol |
| SMILES | Cc1nc2n(n1)C[C@H](NC[C@H](O)c1ccccc1Cl)CC2 |
| InChI | InChI=1S/C15H19ClN4O/c1-10-18-15-7-6-11(9-20(15)19-10)17-8-14(21)12-4-2-3-5-13(12)16/h2-5,11,14,17,21H,6-9H2,1H3/t11-,14+/m1/s1 |
| InChIKey | PHGPQYDDBHUXLR-RISCZKNCSA-N |
| XLogP | 1.88 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |