C18H27N5O — CID 95610620
(2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol (PubChem CID 95610620) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is (2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol.
| Compound Name | (2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 95610620 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol |
| SMILES | Cc1nc2n(n1)C[C@@H](NC[C@H](O)CN(C)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C18H27N5O/c1-14-20-18-9-8-16(12-23(18)21-14)19-10-17(24)13-22(2)11-15-6-4-3-5-7-15/h3-7,16-17,19,24H,8-13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | QZGWRFWTVIZAIT-IRXDYDNUSA-N |
| XLogP | 0.98 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |