C19H29N5O — CID 95343455
(2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol (PubChem CID 95343455) has the molecular formula C19H29N5O and a molecular weight of 343.47 g/mol. Its IUPAC name is (2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol.
| Compound Name | (2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 95343455 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | (2S)-1-[benzyl(methyl)amino]-3-[[(6S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-2-ol |
| SMILES | CCc1nc2n(n1)C[C@@H](NC[C@H](O)CN(C)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C19H29N5O/c1-3-18-21-19-10-9-16(13-24(19)22-18)20-11-17(25)14-23(2)12-15-7-5-4-6-8-15/h4-8,16-17,20,25H,3,9-14H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | AXXPMVXAWAHNBO-IRXDYDNUSA-N |
| XLogP | 1.24 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |