C16H19N5S — CID 95323884
(6R)-N-(1,3-benzothiazol-2-ylmethyl)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95323884) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is (6R)-N-(1,3-benzothiazol-2-ylmethyl)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-(1,3-benzothiazol-2-ylmethyl)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95323884 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (6R)-N-(1,3-benzothiazol-2-ylmethyl)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@H](NCc1nc3ccccc3s1)CC2 |
| InChI | InChI=1S/C16H19N5S/c1-2-14-19-15-8-7-11(10-21(15)20-14)17-9-16-18-12-5-3-4-6-13(12)22-16/h3-6,11,17H,2,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | KSHPAYRUUKACCT-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |