C16H25N5S — CID 95328357
(6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95328357) has the molecular formula C16H25N5S and a molecular weight of 319.48 g/mol. Its IUPAC name is (6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95328357 |
| Molecular Formula | C16H25N5S |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (6S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@@H](NCc1cnc(C(C)(C)C)s1)CC2 |
| InChI | InChI=1S/C16H25N5S/c1-5-13-19-14-7-6-11(10-21(14)20-13)17-8-12-9-18-15(22-12)16(2,3)4/h9,11,17H,5-8,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | NFJPFBAHIVYLCU-NSHDSACASA-N |
| XLogP | 2.70 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |