C13H20N8 — CID 95305594
(6S)-N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95305594) has the molecular formula C13H20N8 and a molecular weight of 288.36 g/mol. Its IUPAC name is (6S)-N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95305594 |
| Molecular Formula | C13H20N8 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (6S)-N-[(1-cyclopropyltetrazol-5-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@@H](NCc1nnnn1C1CC1)CC2 |
| InChI | InChI=1S/C13H20N8/c1-2-11-15-12-6-3-9(8-20(12)17-11)14-7-13-16-18-19-21(13)10-4-5-10/h9-10,14H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | IMTXXRAGPOKJPA-VIFPVBQESA-N |
| XLogP | 0.27 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |