C15H23N7 — CID 95607457
(6R)-N-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95607457) has the molecular formula C15H23N7 and a molecular weight of 301.40 g/mol. Its IUPAC name is (6R)-N-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95607457 |
| Molecular Formula | C15H23N7 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (6R)-N-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@H](NCc1nnc(C3CC3)n1C)CC2 |
| InChI | InChI=1S/C15H23N7/c1-3-12-17-13-7-6-11(9-22(13)20-12)16-8-14-18-19-15(21(14)2)10-4-5-10/h10-11,16H,3-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | LXRNEJPBGLBCIS-LLVKDONJSA-N |
| XLogP | 0.95 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |