C13H22N8 — CID 95344960
(6R)-N-[(1-butyltetrazol-5-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95344960) has the molecular formula C13H22N8 and a molecular weight of 290.38 g/mol. Its IUPAC name is (6R)-N-[(1-butyltetrazol-5-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[(1-butyltetrazol-5-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95344960 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (6R)-N-[(1-butyltetrazol-5-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCCCn1nnnc1CN[C@@H]1CCc2nc(C)nn2C1 |
| InChI | InChI=1S/C13H22N8/c1-3-4-7-20-13(16-18-19-20)8-14-11-5-6-12-15-10(2)17-21(12)9-11/h11,14H,3-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | VZIZVAISZXXCOD-LLVKDONJSA-N |
| XLogP | 0.48 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |