C14H24N4O — CID 95310254
1-[[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]cyclohexan-1-ol (PubChem CID 95310254) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 95310254 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 1-[[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]cyclohexan-1-ol |
| SMILES | Cc1nc2n(n1)C[C@@H](NCC1(O)CCCCC1)CC2 |
| InChI | InChI=1S/C14H24N4O/c1-11-16-13-6-5-12(9-18(13)17-11)15-10-14(19)7-3-2-4-8-14/h12,15,19H,2-10H2,1H3/t12-/m0/s1 |
| InChIKey | MHWPHWFDOGMRCT-LBPRGKRZSA-N |
| XLogP | 1.19 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |