C15H24N6O2 — CID 95979274
(2S)-N-methyl-1-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 95979274) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is (2S)-N-methyl-1-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-methyl-1-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95979274 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (2S)-N-methyl-1-[2-[[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CCCN1C(=O)CN[C@H]1CCc2nc(C)nn2C1 |
| InChI | InChI=1S/C15H24N6O2/c1-10-18-13-6-5-11(9-21(13)19-10)17-8-14(22)20-7-3-4-12(20)15(23)16-2/h11-12,17H,3-9H2,1-2H3,(H,16,23)/t11-,12-/m0/s1 |
| InChIKey | DINAGVHIPWOVMA-RYUDHWBXSA-N |
| XLogP | -0.77 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |