C18H23N5O — CID 95612111
1-(2,3-dihydroindol-1-yl)-3-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-1-one (PubChem CID 95612111) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-1-one |
|---|---|
| PubChem CID | 95612111 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propan-1-one |
| SMILES | Cc1nc2n(n1)C[C@H](NCCC(=O)N1CCc3ccccc31)CC2 |
| InChI | InChI=1S/C18H23N5O/c1-13-20-17-7-6-15(12-23(17)21-13)19-10-8-18(24)22-11-9-14-4-2-3-5-16(14)22/h2-5,15,19H,6-12H2,1H3/t15-/m1/s1 |
| InChIKey | KEFAFCFYPMXGOF-OAHLLOKOSA-N |
| XLogP | 1.47 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |