C13H16N2O — CID 60648595
2-(cyclopropylamino)-1-(2,3-dihydroindol-1-yl)ethanone (PubChem CID 60648595) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1-(2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(cyclopropylamino)-1-(2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 60648595 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-(cyclopropylamino)-1-(2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(CNC1CC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C13H16N2O/c16-13(9-14-11-5-6-11)15-8-7-10-3-1-2-4-12(10)15/h1-4,11,14H,5-9H2 |
| InChIKey | RYFBHCWKVOSPRW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |