C25H28N4O3 — CID 78862673
2-[bis[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-N-cyclopropylacetamide (PubChem CID 78862673) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[bis[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-N-cyclopropylacetamide.
| Compound Name | 2-[bis[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 78862673 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-[bis[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-N-cyclopropylacetamide |
| SMILES | O=C(CN(CC(=O)N1CCc2ccccc21)CC(=O)N1CCc2ccccc21)NC1CC1 |
| InChI | InChI=1S/C25H28N4O3/c30-23(26-20-9-10-20)15-27(16-24(31)28-13-11-18-5-1-3-7-21(18)28)17-25(32)29-14-12-19-6-2-4-8-22(19)29/h1-8,20H,9-17H2,(H,26,30) |
| InChIKey | BDNLLABUQVYFQC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |