C20H25N5 — CID 133437607
3-ethyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylquinolin-4-amine (PubChem CID 133437607) has the molecular formula C20H25N5 and a molecular weight of 335.46 g/mol. Its IUPAC name is 3-ethyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylquinolin-4-amine.
| Compound Name | 3-ethyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 133437607 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-ethyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methylquinolin-4-amine |
| SMILES | CCc1nc2n(n1)CC(Nc1c(CC)c(C)nc3ccccc13)CC2 |
| InChI | InChI=1S/C20H25N5/c1-4-15-13(3)21-17-9-7-6-8-16(17)20(15)22-14-10-11-19-23-18(5-2)24-25(19)12-14/h6-9,14H,4-5,10-12H2,1-3H3,(H,21,22) |
| InChIKey | GAMQUYNBFVUZPJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |