C17H18ClN5 — CID 133281768
7-chloro-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinolin-4-amine (PubChem CID 133281768) has the molecular formula C17H18ClN5 and a molecular weight of 327.82 g/mol. Its IUPAC name is 7-chloro-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinolin-4-amine.
| Compound Name | 7-chloro-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 133281768 |
| Molecular Formula | C17H18ClN5 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 7-chloro-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)quinolin-4-amine |
| SMILES | CCc1nc2n(n1)CC(Nc1ccnc3cc(Cl)ccc13)CC2 |
| InChI | InChI=1S/C17H18ClN5/c1-2-16-21-17-6-4-12(10-23(17)22-16)20-14-7-8-19-15-9-11(18)3-5-13(14)15/h3,5,7-9,12H,2,4,6,10H2,1H3,(H,19,20) |
| InChIKey | XHUYMLUFOUJVKV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |