C18H21N5O — CID 133369039
N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-8-methylquinolin-4-amine (PubChem CID 133369039) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-8-methylquinolin-4-amine.
| Compound Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-8-methylquinolin-4-amine |
|---|---|
| PubChem CID | 133369039 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-8-methylquinolin-4-amine |
| SMILES | COCc1nc2n(n1)CC(Nc1ccnc3c(C)cccc13)CC2 |
| InChI | InChI=1S/C18H21N5O/c1-12-4-3-5-14-15(8-9-19-18(12)14)20-13-6-7-17-21-16(11-24-2)22-23(17)10-13/h3-5,8-9,13H,6-7,10-11H2,1-2H3,(H,19,20) |
| InChIKey | JHEDXICOOLUOSM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |