C16H22N6O3 — CID 166202903
ethyl 2-[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-4-methylpyrimidine-5-carboxylate (PubChem CID 166202903) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is ethyl 2-[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-4-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166202903 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | ethyl 2-[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-4-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC2CCc3nc(COC)nn3C2)nc1C |
| InChI | InChI=1S/C16H22N6O3/c1-4-25-15(23)12-7-17-16(18-10(12)2)19-11-5-6-14-20-13(9-24-3)21-22(14)8-11/h7,11H,4-6,8-9H2,1-3H3,(H,17,18,19) |
| InChIKey | CTBBTEYIFKXYIE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |