C14H18N6O2 — CID 133281658
methyl 6-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazine-3-carboxylate (PubChem CID 133281658) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is methyl 6-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 133281658 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | methyl 6-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazine-3-carboxylate |
| SMILES | CCc1nc2n(n1)CC(Nc1ccc(C(=O)OC)nn1)CC2 |
| InChI | InChI=1S/C14H18N6O2/c1-3-11-16-13-7-4-9(8-20(13)19-11)15-12-6-5-10(17-18-12)14(21)22-2/h5-6,9H,3-4,7-8H2,1-2H3,(H,15,18) |
| InChIKey | JFLXSCNOQALSMF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |