C19H20N8 — CID 133281716
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133281716) has the molecular formula C19H20N8 and a molecular weight of 360.43 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133281716 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CCc1nc2n(n1)CC(Nc1ccc3nnc(-c4ccccc4)n3n1)CC2 |
| InChI | InChI=1S/C19H20N8/c1-2-15-21-17-10-8-14(12-26(17)24-15)20-16-9-11-18-22-23-19(27(18)25-16)13-6-4-3-5-7-13/h3-7,9,11,14H,2,8,10,12H2,1H3,(H,20,25) |
| InChIKey | ONGHXTZBLAPNFO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |