C22H23N7O2S — CID 133281669
N-[3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 133281669) has the molecular formula C22H23N7O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 133281669 |
| Molecular Formula | C22H23N7O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | CCc1nc2n(n1)CC(Nc1nc3ccccc3nc1NS(=O)(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C22H23N7O2S/c1-2-19-26-20-13-12-15(14-29(20)27-19)23-21-22(25-18-11-7-6-10-17(18)24-21)28-32(30,31)16-8-4-3-5-9-16/h3-11,15H,2,12-14H2,1H3,(H,23,24)(H,25,28) |
| InChIKey | OCSUOVJPSSBJEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |