C21H21N7 — CID 133281755
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 133281755) has the molecular formula C21H21N7 and a molecular weight of 371.45 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 133281755 |
| Molecular Formula | C21H21N7 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | CCc1nc2n(n1)CC(Nc1nc(-c3ccncc3)nc3ccccc13)CC2 |
| InChI | InChI=1S/C21H21N7/c1-2-18-25-19-8-7-15(13-28(19)27-18)23-21-16-5-3-4-6-17(16)24-20(26-21)14-9-11-22-12-10-14/h3-6,9-12,15H,2,7-8,13H2,1H3,(H,23,24,26) |
| InChIKey | ZCKCMWJOECQQBI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |